C12H12N2O2S2 — CID 82899045
4-amino-3-phenylsulfanylbenzenesulfonamide (PubChem CID 82899045) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-amino-3-phenylsulfanylbenzenesulfonamide.
| Compound Name | 4-amino-3-phenylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 82899045 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 4-amino-3-phenylsulfanylbenzenesulfonamide |
| SMILES | Nc1ccc(S(N)(=O)=O)cc1Sc1ccccc1 |
| InChI | InChI=1S/C12H12N2O2S2/c13-11-7-6-10(18(14,15)16)8-12(11)17-9-4-2-1-3-5-9/h1-8H,13H2,(H2,14,15,16) |
| InChIKey | UNJOGQWZVHIKLO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|