C9H10N4O2S3 — CID 82898337
4-amino-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenesulfonamide (PubChem CID 82898337) has the molecular formula C9H10N4O2S3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 4-amino-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenesulfonamide.
| Compound Name | 4-amino-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 82898337 |
| Molecular Formula | C9H10N4O2S3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 4-amino-3-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenesulfonamide |
| SMILES | Cc1nsc(Sc2cc(S(N)(=O)=O)ccc2N)n1 |
| InChI | InChI=1S/C9H10N4O2S3/c1-5-12-9(17-13-5)16-8-4-6(18(11,14)15)2-3-7(8)10/h2-4H,10H2,1H3,(H2,11,14,15) |
| InChIKey | UDHNWECJFOATQY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|