C10H12N4O2S3 — CID 103287963
5-amino-N-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenesulfonamide (PubChem CID 103287963) has the molecular formula C10H12N4O2S3 and a molecular weight of 316.43 g/mol. Its IUPAC name is 5-amino-N-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenesulfonamide.
| Compound Name | 5-amino-N-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103287963 |
| Molecular Formula | C10H12N4O2S3 |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 5-amino-N-methyl-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(N)ccc1Sc1nc(C)ns1 |
| InChI | InChI=1S/C10H12N4O2S3/c1-6-13-10(18-14-6)17-8-4-3-7(11)5-9(8)19(15,16)12-2/h3-5,12H,11H2,1-2H3 |
| InChIKey | CVDVELCSHFKFTO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|