C9H7BrFN3S2 — CID 116736865
4-bromo-5-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline (PubChem CID 116736865) has the molecular formula C9H7BrFN3S2 and a molecular weight of 320.21 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline.
| Compound Name | 4-bromo-5-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 116736865 |
| Molecular Formula | C9H7BrFN3S2 |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.92 |
| IUPAC Name | 4-bromo-5-fluoro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline |
| SMILES | Cc1nsc(Sc2cc(Br)c(F)cc2N)n1 |
| InChI | InChI=1S/C9H7BrFN3S2/c1-4-13-9(16-14-4)15-8-2-5(10)6(11)3-7(8)12/h2-3H,12H2,1H3 |
| InChIKey | UWWSCBNUDRRRJD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|