C6H4BrF2N — CID 2773285
4-bromo-2,5-difluoroaniline (PubChem CID 2773285) has the molecular formula C6H4BrF2N and a molecular weight of 208.00 g/mol. Its IUPAC name is 4-bromo-2,5-difluoroaniline.
| Compound Name | 4-bromo-2,5-difluoroaniline |
|---|---|
| PubChem CID | 2773285 |
| Molecular Formula | C6H4BrF2N |
| Molecular Weight | 208.00 g/mol |
| Exact Mass | 206.95 |
| IUPAC Name | 4-bromo-2,5-difluoroaniline |
| SMILES | Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C6H4BrF2N/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,10H2 |
| InChIKey | XOYHFIQPPOJMFK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.00 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|