C12H7Br2F3N2 — CID 116736046
4-bromo-2-N-(4-bromo-2,6-difluorophenyl)-5-fluorobenzene-1,2-diamine (PubChem CID 116736046) has the molecular formula C12H7Br2F3N2 and a molecular weight of 396.00 g/mol. Its IUPAC name is 4-bromo-2-N-(4-bromo-2,6-difluorophenyl)-5-fluorobenzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-(4-bromo-2,6-difluorophenyl)-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 116736046 |
| Molecular Formula | C12H7Br2F3N2 |
| Molecular Weight | 396.00 g/mol |
| Exact Mass | 393.89 |
| IUPAC Name | 4-bromo-2-N-(4-bromo-2,6-difluorophenyl)-5-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(F)c(Br)cc1Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H7Br2F3N2/c13-5-1-8(16)12(9(17)2-5)19-11-3-6(14)7(15)4-10(11)18/h1-4,19H,18H2 |
| InChIKey | LZWQZSHMCBIJCE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.00 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|