C14H12BrF2N3O — CID 65468692
4-amino-3-(4-bromo-2,6-difluoroanilino)-N-methylbenzamide (PubChem CID 65468692) has the molecular formula C14H12BrF2N3O and a molecular weight of 356.17 g/mol. Its IUPAC name is 4-amino-3-(4-bromo-2,6-difluoroanilino)-N-methylbenzamide.
| Compound Name | 4-amino-3-(4-bromo-2,6-difluoroanilino)-N-methylbenzamide |
|---|---|
| PubChem CID | 65468692 |
| Molecular Formula | C14H12BrF2N3O |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 4-amino-3-(4-bromo-2,6-difluoroanilino)-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N)c(Nc2c(F)cc(Br)cc2F)c1 |
| InChI | InChI=1S/C14H12BrF2N3O/c1-19-14(21)7-2-3-11(18)12(4-7)20-13-9(16)5-8(15)6-10(13)17/h2-6,20H,18H2,1H3,(H,19,21) |
| InChIKey | UBVVMDPBZFCAJG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|