C14H13F2N3O — CID 63357203
4-amino-3-(2,6-difluoroanilino)-N-methylbenzamide (PubChem CID 63357203) has the molecular formula C14H13F2N3O and a molecular weight of 277.27 g/mol. Its IUPAC name is 4-amino-3-(2,6-difluoroanilino)-N-methylbenzamide.
| Compound Name | 4-amino-3-(2,6-difluoroanilino)-N-methylbenzamide |
|---|---|
| PubChem CID | 63357203 |
| Molecular Formula | C14H13F2N3O |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-amino-3-(2,6-difluoroanilino)-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N)c(Nc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C14H13F2N3O/c1-18-14(20)8-5-6-11(17)12(7-8)19-13-9(15)3-2-4-10(13)16/h2-7,19H,17H2,1H3,(H,18,20) |
| InChIKey | ADQOCXUYFFMDKG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|