C13H10Br3FN2O — CID 103410813
4-bromo-2-N-(2,4-dibromo-5-methoxyphenyl)-5-fluorobenzene-1,2-diamine (PubChem CID 103410813) has the molecular formula C13H10Br3FN2O and a molecular weight of 468.95 g/mol. Its IUPAC name is 4-bromo-2-N-(2,4-dibromo-5-methoxyphenyl)-5-fluorobenzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-(2,4-dibromo-5-methoxyphenyl)-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 103410813 |
| Molecular Formula | C13H10Br3FN2O |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 465.83 |
| IUPAC Name | 4-bromo-2-N-(2,4-dibromo-5-methoxyphenyl)-5-fluorobenzene-1,2-diamine |
| SMILES | COc1cc(Nc2cc(Br)c(F)cc2N)c(Br)cc1Br |
| InChI | InChI=1S/C13H10Br3FN2O/c1-20-13-5-11(7(15)2-8(13)16)19-12-3-6(14)9(17)4-10(12)18/h2-5,19H,18H2,1H3 |
| InChIKey | SOFSLAVNKIYDJN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|