C14H12Br2N4O — CID 107491236
6-N-(2,4-dibromo-5-methoxyphenyl)-1H-indazole-5,6-diamine (PubChem CID 107491236) has the molecular formula C14H12Br2N4O and a molecular weight of 412.09 g/mol. Its IUPAC name is 6-N-(2,4-dibromo-5-methoxyphenyl)-1H-indazole-5,6-diamine.
| Compound Name | 6-N-(2,4-dibromo-5-methoxyphenyl)-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107491236 |
| Molecular Formula | C14H12Br2N4O |
| Molecular Weight | 412.09 g/mol |
| Exact Mass | 409.94 |
| IUPAC Name | 6-N-(2,4-dibromo-5-methoxyphenyl)-1H-indazole-5,6-diamine |
| SMILES | COc1cc(Nc2cc3[nH]ncc3cc2N)c(Br)cc1Br |
| InChI | InChI=1S/C14H12Br2N4O/c1-21-14-5-12(8(15)3-9(14)16)19-13-4-11-7(2-10(13)17)6-18-20-11/h2-6,19H,17H2,1H3,(H,18,20) |
| InChIKey | OCQPRKSRAVTOHD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.09 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|