C13H13Br2N3O — CID 103410626
2-N-(2,4-dibromo-5-methoxyphenyl)-6-methylpyridine-2,5-diamine (PubChem CID 103410626) has the molecular formula C13H13Br2N3O and a molecular weight of 387.08 g/mol. Its IUPAC name is 2-N-(2,4-dibromo-5-methoxyphenyl)-6-methylpyridine-2,5-diamine.
| Compound Name | 2-N-(2,4-dibromo-5-methoxyphenyl)-6-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 103410626 |
| Molecular Formula | C13H13Br2N3O |
| Molecular Weight | 387.08 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | 2-N-(2,4-dibromo-5-methoxyphenyl)-6-methylpyridine-2,5-diamine |
| SMILES | COc1cc(Nc2ccc(N)c(C)n2)c(Br)cc1Br |
| InChI | InChI=1S/C13H13Br2N3O/c1-7-10(16)3-4-13(17-7)18-11-6-12(19-2)9(15)5-8(11)14/h3-6H,16H2,1-2H3,(H,17,18) |
| InChIKey | LTQFEPMMEDBHRN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.08 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |