C14H15Br2N3O — CID 103417125
6-N-(2,4-dibromo-5-methoxyphenyl)-2-N-ethylpyridine-2,6-diamine (PubChem CID 103417125) has the molecular formula C14H15Br2N3O and a molecular weight of 401.10 g/mol. Its IUPAC name is 6-N-(2,4-dibromo-5-methoxyphenyl)-2-N-ethylpyridine-2,6-diamine.
| Compound Name | 6-N-(2,4-dibromo-5-methoxyphenyl)-2-N-ethylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 103417125 |
| Molecular Formula | C14H15Br2N3O |
| Molecular Weight | 401.10 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | 6-N-(2,4-dibromo-5-methoxyphenyl)-2-N-ethylpyridine-2,6-diamine |
| SMILES | CCNc1cccc(Nc2cc(OC)c(Br)cc2Br)n1 |
| InChI | InChI=1S/C14H15Br2N3O/c1-3-17-13-5-4-6-14(19-13)18-11-8-12(20-2)10(16)7-9(11)15/h4-8H,3H2,1-2H3,(H2,17,18,19) |
| InChIKey | YFAQXVBCQCEOFI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.10 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |