C14H16BrN3O — CID 82862442
6-N-(3-bromo-5-methoxyphenyl)-2-N-ethylpyridine-2,6-diamine (PubChem CID 82862442) has the molecular formula C14H16BrN3O and a molecular weight of 322.21 g/mol. Its IUPAC name is 6-N-(3-bromo-5-methoxyphenyl)-2-N-ethylpyridine-2,6-diamine.
| Compound Name | 6-N-(3-bromo-5-methoxyphenyl)-2-N-ethylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 82862442 |
| Molecular Formula | C14H16BrN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 6-N-(3-bromo-5-methoxyphenyl)-2-N-ethylpyridine-2,6-diamine |
| SMILES | CCNc1cccc(Nc2cc(Br)cc(OC)c2)n1 |
| InChI | InChI=1S/C14H16BrN3O/c1-3-16-13-5-4-6-14(18-13)17-11-7-10(15)8-12(9-11)19-2/h4-9H,3H2,1-2H3,(H2,16,17,18) |
| InChIKey | UBZOPGFNTGGVNN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |