C14H15F2N3O — CID 80753539
6-N-[4-(difluoromethoxy)phenyl]-2-N-ethylpyridine-2,6-diamine (PubChem CID 80753539) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is 6-N-[4-(difluoromethoxy)phenyl]-2-N-ethylpyridine-2,6-diamine.
| Compound Name | 6-N-[4-(difluoromethoxy)phenyl]-2-N-ethylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80753539 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 6-N-[4-(difluoromethoxy)phenyl]-2-N-ethylpyridine-2,6-diamine |
| SMILES | CCNc1cccc(Nc2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C14H15F2N3O/c1-2-17-12-4-3-5-13(19-12)18-10-6-8-11(9-7-10)20-14(15)16/h3-9,14H,2H2,1H3,(H2,17,18,19) |
| InChIKey | NTDLZRUNYVYBGB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |