C9H14FN3 — CID 130505047
2-N-ethyl-6-N-(2-fluoroethyl)pyridine-2,6-diamine (PubChem CID 130505047) has the molecular formula C9H14FN3 and a molecular weight of 183.23 g/mol. Its IUPAC name is 2-N-ethyl-6-N-(2-fluoroethyl)pyridine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-(2-fluoroethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 130505047 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | 2-N-ethyl-6-N-(2-fluoroethyl)pyridine-2,6-diamine |
| SMILES | CCNc1cccc(NCCF)n1 |
| InChI | InChI=1S/C9H14FN3/c1-2-11-8-4-3-5-9(13-8)12-7-6-10/h3-5H,2,6-7H2,1H3,(H2,11,12,13) |
| InChIKey | JYTFVFZBSFRSPW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |