C14H23N3O — CID 80846644
6-N-(2-cyclopentyloxyethyl)-2-N-ethylpyridine-2,6-diamine (PubChem CID 80846644) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 6-N-(2-cyclopentyloxyethyl)-2-N-ethylpyridine-2,6-diamine.
| Compound Name | 6-N-(2-cyclopentyloxyethyl)-2-N-ethylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80846644 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 6-N-(2-cyclopentyloxyethyl)-2-N-ethylpyridine-2,6-diamine |
| SMILES | CCNc1cccc(NCCOC2CCCC2)n1 |
| InChI | InChI=1S/C14H23N3O/c1-2-15-13-8-5-9-14(17-13)16-10-11-18-12-6-3-4-7-12/h5,8-9,12H,2-4,6-7,10-11H2,1H3,(H2,15,16,17) |
| InChIKey | GSLAPMDIYVLKES-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|