C12H19N3O — CID 80647858
6-N-(2-cyclopentyloxyethyl)pyridine-2,6-diamine (PubChem CID 80647858) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 6-N-(2-cyclopentyloxyethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(2-cyclopentyloxyethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80647858 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 6-N-(2-cyclopentyloxyethyl)pyridine-2,6-diamine |
| SMILES | Nc1cccc(NCCOC2CCCC2)n1 |
| InChI | InChI=1S/C12H19N3O/c13-11-6-3-7-12(15-11)14-8-9-16-10-4-1-2-5-10/h3,6-7,10H,1-2,4-5,8-9H2,(H3,13,14,15) |
| InChIKey | CGWZNHMYBFRMKB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|