C13H21N3O2 — CID 63826021
2-N-(2-cyclopentyloxyethyl)-6-methoxypyridine-2,5-diamine (PubChem CID 63826021) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-N-(2-cyclopentyloxyethyl)-6-methoxypyridine-2,5-diamine.
| Compound Name | 2-N-(2-cyclopentyloxyethyl)-6-methoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 63826021 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-N-(2-cyclopentyloxyethyl)-6-methoxypyridine-2,5-diamine |
| SMILES | COc1nc(NCCOC2CCCC2)ccc1N |
| InChI | InChI=1S/C13H21N3O2/c1-17-13-11(14)6-7-12(16-13)15-8-9-18-10-4-2-3-5-10/h6-7,10H,2-5,8-9,14H2,1H3,(H,15,16) |
| InChIKey | HCKWQVWGJIAWQE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|