C10H16N4O3 — CID 106234342
2-[2-[(5-amino-6-methoxy-2-pyridinyl)amino]ethoxy]acetamide (PubChem CID 106234342) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-[2-[(5-amino-6-methoxy-2-pyridinyl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(5-amino-6-methoxy-2-pyridinyl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106234342 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-[2-[(5-amino-6-methoxy-2-pyridinyl)amino]ethoxy]acetamide |
| SMILES | COc1nc(NCCOCC(N)=O)ccc1N |
| InChI | InChI=1S/C10H16N4O3/c1-16-10-7(11)2-3-9(14-10)13-4-5-17-6-8(12)15/h2-3H,4-6,11H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | OPCCYRQOBCSWCS-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|