C8H12N4O2 — CID 43260954
2-[(5-amino-6-methoxy-2-pyridinyl)amino]acetamide (PubChem CID 43260954) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-[(5-amino-6-methoxy-2-pyridinyl)amino]acetamide.
| Compound Name | 2-[(5-amino-6-methoxy-2-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 43260954 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-[(5-amino-6-methoxy-2-pyridinyl)amino]acetamide |
| SMILES | COc1nc(NCC(N)=O)ccc1N |
| InChI | InChI=1S/C8H12N4O2/c1-14-8-5(9)2-3-7(12-8)11-4-6(10)13/h2-3H,4,9H2,1H3,(H2,10,13)(H,11,12) |
| InChIKey | GYANVDVIDNLAPK-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |