C9H14N4O2 — CID 106234601
2-[2-[(4-amino-2-pyridinyl)amino]ethoxy]acetamide (PubChem CID 106234601) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-[2-[(4-amino-2-pyridinyl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(4-amino-2-pyridinyl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106234601 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-[2-[(4-amino-2-pyridinyl)amino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNc1cc(N)ccn1 |
| InChI | InChI=1S/C9H14N4O2/c10-7-1-2-12-9(5-7)13-3-4-15-6-8(11)14/h1-2,5H,3-4,6H2,(H2,11,14)(H3,10,12,13) |
| InChIKey | DAHHCYIEKMAJBX-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|