C10H14ClN3O2 — CID 106234293
2-[2-(4-amino-2-chloroanilino)ethoxy]acetamide (PubChem CID 106234293) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is 2-[2-(4-amino-2-chloroanilino)ethoxy]acetamide.
| Compound Name | 2-[2-(4-amino-2-chloroanilino)ethoxy]acetamide |
|---|---|
| PubChem CID | 106234293 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-[2-(4-amino-2-chloroanilino)ethoxy]acetamide |
| SMILES | NC(=O)COCCNc1ccc(N)cc1Cl |
| InChI | InChI=1S/C10H14ClN3O2/c11-8-5-7(12)1-2-9(8)14-3-4-16-6-10(13)15/h1-2,5,14H,3-4,6,12H2,(H2,13,15) |
| InChIKey | LCCPHWDXEFPQQH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|