C11H17N3O4S — CID 106233837
2-[2-[(4-amino-2-methylphenyl)sulfonylamino]ethoxy]acetamide (PubChem CID 106233837) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-[2-[(4-amino-2-methylphenyl)sulfonylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(4-amino-2-methylphenyl)sulfonylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106233837 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[2-[(4-amino-2-methylphenyl)sulfonylamino]ethoxy]acetamide |
| SMILES | Cc1cc(N)ccc1S(=O)(=O)NCCOCC(N)=O |
| InChI | InChI=1S/C11H17N3O4S/c1-8-6-9(12)2-3-10(8)19(16,17)14-4-5-18-7-11(13)15/h2-3,6,14H,4-5,7,12H2,1H3,(H2,13,15) |
| InChIKey | SWKPLJGYAVWUOI-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|