C10H16N2O3S2 — CID 113479654
4-amino-2-methyl-N-(2-methylsulfinylethyl)benzenesulfonamide (PubChem CID 113479654) has the molecular formula C10H16N2O3S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-amino-2-methyl-N-(2-methylsulfinylethyl)benzenesulfonamide.
| Compound Name | 4-amino-2-methyl-N-(2-methylsulfinylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113479654 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 4-amino-2-methyl-N-(2-methylsulfinylethyl)benzenesulfonamide |
| SMILES | Cc1cc(N)ccc1S(=O)(=O)NCCS(C)=O |
| InChI | InChI=1S/C10H16N2O3S2/c1-8-7-9(11)3-4-10(8)17(14,15)12-5-6-16(2)13/h3-4,7,12H,5-6,11H2,1-2H3 |
| InChIKey | GFYRZKVIJQTKQW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|