C11H13BrN2O6S — CID 104655952
4-[2-(2-amino-2-oxoethoxy)ethylsulfamoyl]-3-bromobenzoic acid (PubChem CID 104655952) has the molecular formula C11H13BrN2O6S and a molecular weight of 381.20 g/mol. Its IUPAC name is 4-[2-(2-amino-2-oxoethoxy)ethylsulfamoyl]-3-bromobenzoic acid.
| Compound Name | 4-[2-(2-amino-2-oxoethoxy)ethylsulfamoyl]-3-bromobenzoic acid |
|---|---|
| PubChem CID | 104655952 |
| Molecular Formula | C11H13BrN2O6S |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 4-[2-(2-amino-2-oxoethoxy)ethylsulfamoyl]-3-bromobenzoic acid |
| SMILES | NC(=O)COCCNS(=O)(=O)c1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C11H13BrN2O6S/c12-8-5-7(11(16)17)1-2-9(8)21(18,19)14-3-4-20-6-10(13)15/h1-2,5,14H,3-4,6H2,(H2,13,15)(H,16,17) |
| InChIKey | LWERMUMEWZZKRN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|