C10H14N2O4S — CID 103766575
2-[2-(benzenesulfonamido)ethoxy]acetamide (PubChem CID 103766575) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-[2-(benzenesulfonamido)ethoxy]acetamide.
| Compound Name | 2-[2-(benzenesulfonamido)ethoxy]acetamide |
|---|---|
| PubChem CID | 103766575 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[2-(benzenesulfonamido)ethoxy]acetamide |
| SMILES | NC(=O)COCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H14N2O4S/c11-10(13)8-16-7-6-12-17(14,15)9-4-2-1-3-5-9/h1-5,12H,6-8H2,(H2,11,13) |
| InChIKey | HNENLSLJJRVVSC-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|