C14H23N3O5S — CID 160918507
1-[2-[2-[2-(benzenesulfonamido)ethoxy]ethoxy]ethyl]-3-methylurea (PubChem CID 160918507) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-[2-[2-[2-(benzenesulfonamido)ethoxy]ethoxy]ethyl]-3-methylurea.
| Compound Name | 1-[2-[2-[2-(benzenesulfonamido)ethoxy]ethoxy]ethyl]-3-methylurea |
|---|---|
| PubChem CID | 160918507 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-[2-[2-[2-(benzenesulfonamido)ethoxy]ethoxy]ethyl]-3-methylurea |
| SMILES | CNC(=O)NCCOCCOCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H23N3O5S/c1-15-14(18)16-7-9-21-11-12-22-10-8-17-23(19,20)13-5-3-2-4-6-13/h2-6,17H,7-12H2,1H3,(H2,15,16,18) |
| InChIKey | SRSLAQIGBMMIRI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|