C20H26N2O7S — CID 118524153
2-[2-[2-[(4-phenylmethoxyphenyl)sulfonylamino]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 118524153) has the molecular formula C20H26N2O7S and a molecular weight of 438.50 g/mol. Its IUPAC name is 2-[2-[2-[(4-phenylmethoxyphenyl)sulfonylamino]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[(4-phenylmethoxyphenyl)sulfonylamino]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 118524153 |
| Molecular Formula | C20H26N2O7S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[2-[2-[(4-phenylmethoxyphenyl)sulfonylamino]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOCCOCCNS(=O)(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2O7S/c23-20(24)21-10-12-27-14-15-28-13-11-22-30(25,26)19-8-6-18(7-9-19)29-16-17-4-2-1-3-5-17/h1-9,21-22H,10-16H2,(H,23,24) |
| InChIKey | WNCDNGADUUQDSL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|