C17H29N3O8S — CID 155168943
2-[2-[2-[2-[2-[(4-aminophenyl)sulfonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 155168943) has the molecular formula C17H29N3O8S and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[(4-aminophenyl)sulfonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[2-[2-[(4-aminophenyl)sulfonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 155168943 |
| Molecular Formula | C17H29N3O8S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[2-[2-[2-[2-[(4-aminophenyl)sulfonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | Nc1ccc(S(=O)(=O)NCCOCCOCCOCCOCCNC(=O)O)cc1 |
| InChI | InChI=1S/C17H29N3O8S/c18-15-1-3-16(4-2-15)29(23,24)20-6-8-26-10-12-28-14-13-27-11-9-25-7-5-19-17(21)22/h1-4,19-20H,5-14,18H2,(H,21,22) |
| InChIKey | NDZJPJKNDOVNLG-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|