C9H11BrN2O4S — CID 68632814
2-[(4-bromophenyl)sulfonylamino]ethylcarbamic acid (PubChem CID 68632814) has the molecular formula C9H11BrN2O4S and a molecular weight of 323.17 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonylamino]ethylcarbamic acid.
| Compound Name | 2-[(4-bromophenyl)sulfonylamino]ethylcarbamic acid |
|---|---|
| PubChem CID | 68632814 |
| Molecular Formula | C9H11BrN2O4S |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonylamino]ethylcarbamic acid |
| SMILES | O=C(O)NCCNS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H11BrN2O4S/c10-7-1-3-8(4-2-7)17(15,16)12-6-5-11-9(13)14/h1-4,11-12H,5-6H2,(H,13,14) |
| InChIKey | WECKHNRMYFEJIF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|