C11H16N2O5S2 — CID 110759438
N-[2-[(4-methylsulfonylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 110759438) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[2-[(4-methylsulfonylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[(4-methylsulfonylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 110759438 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N-[2-[(4-methylsulfonylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H16N2O5S2/c1-9(14)12-7-8-13-20(17,18)11-5-3-10(4-6-11)19(2,15)16/h3-6,13H,7-8H2,1-2H3,(H,12,14) |
| InChIKey | LKYQTCLRKUNPSF-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|