C15H15BrN2O4S — CID 108575028
N-[2-[(4-bromophenyl)sulfonylamino]ethyl]-3-hydroxybenzamide (PubChem CID 108575028) has the molecular formula C15H15BrN2O4S and a molecular weight of 399.27 g/mol. Its IUPAC name is N-[2-[(4-bromophenyl)sulfonylamino]ethyl]-3-hydroxybenzamide.
| Compound Name | N-[2-[(4-bromophenyl)sulfonylamino]ethyl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 108575028 |
| Molecular Formula | C15H15BrN2O4S |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | N-[2-[(4-bromophenyl)sulfonylamino]ethyl]-3-hydroxybenzamide |
| SMILES | O=C(NCCNS(=O)(=O)c1ccc(Br)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C15H15BrN2O4S/c16-12-4-6-14(7-5-12)23(21,22)18-9-8-17-15(20)11-2-1-3-13(19)10-11/h1-7,10,18-19H,8-9H2,(H,17,20) |
| InChIKey | CNCQJQPWRKUORH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|