C17H20N2O4S — CID 108575024
N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-3-hydroxybenzamide (PubChem CID 108575024) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-3-hydroxybenzamide.
| Compound Name | N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 108575024 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-3-hydroxybenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)c2cccc(O)c2)c(C)c1 |
| InChI | InChI=1S/C17H20N2O4S/c1-12-6-7-16(13(2)10-12)24(22,23)19-9-8-18-17(21)14-4-3-5-15(20)11-14/h3-7,10-11,19-20H,8-9H2,1-2H3,(H,18,21) |
| InChIKey | DCPYWSPRRXCBJC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|