C20H26N2O6S — CID 108570759
N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 108570759) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 108570759 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-[2-[(2,4-dimethylphenyl)sulfonylamino]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCNS(=O)(=O)c2ccc(C)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C20H26N2O6S/c1-13-6-7-18(14(2)10-13)29(24,25)22-9-8-21-20(23)15-11-16(26-3)19(28-5)17(12-15)27-4/h6-7,10-12,22H,8-9H2,1-5H3,(H,21,23) |
| InChIKey | DYUURJQXUCAOOR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|