C23H32N2O6S — CID 46402299
N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3,4,5-triethoxybenzamide (PubChem CID 46402299) has the molecular formula C23H32N2O6S and a molecular weight of 464.58 g/mol. Its IUPAC name is N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 46402299 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCCNS(=O)(=O)c2cc(C)ccc2C)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H32N2O6S/c1-6-29-19-14-18(15-20(30-7-2)22(19)31-8-3)23(26)24-11-12-25-32(27,28)21-13-16(4)9-10-17(21)5/h9-10,13-15,25H,6-8,11-12H2,1-5H3,(H,24,26) |
| InChIKey | YLJPHPUMVNRUMC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|