C16H20N4O3S — CID 51084190
1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-pyridin-2-ylurea (PubChem CID 51084190) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-pyridin-2-ylurea.
| Compound Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 51084190 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-pyridin-2-ylurea |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCNC(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C16H20N4O3S/c1-12-6-7-13(2)14(11-12)24(22,23)19-10-9-18-16(21)20-15-5-3-4-8-17-15/h3-8,11,19H,9-10H2,1-2H3,(H2,17,18,20,21) |
| InChIKey | PCRSCRNICFGVMT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|