C20H24N2O3S — CID 32996503
(E)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-(3-methylphenyl)prop-2-enamide (PubChem CID 32996503) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is (E)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-(3-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 32996503 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (E)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(/C=C/C(=O)NCCNS(=O)(=O)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C20H24N2O3S/c1-15-5-4-6-18(13-15)9-10-20(23)21-11-12-22-26(24,25)19-14-16(2)7-8-17(19)3/h4-10,13-14,22H,11-12H2,1-3H3,(H,21,23)/b10-9+ |
| InChIKey | ZUAHABHJRQBHMY-MDZDMXLPSA-N |
| XLogP | 2.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|