C16H19N3O4S — CID 97378357
(Z)-3-(3-methylphenyl)-N-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]prop-2-enamide (PubChem CID 97378357) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is (Z)-3-(3-methylphenyl)-N-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-(3-methylphenyl)-N-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 97378357 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (Z)-3-(3-methylphenyl)-N-[2-(1,2-oxazol-3-ylmethylsulfonylamino)ethyl]prop-2-enamide |
| SMILES | Cc1cccc(/C=C\C(=O)NCCNS(=O)(=O)Cc2ccon2)c1 |
| InChI | InChI=1S/C16H19N3O4S/c1-13-3-2-4-14(11-13)5-6-16(20)17-8-9-18-24(21,22)12-15-7-10-23-19-15/h2-7,10-11,18H,8-9,12H2,1H3,(H,17,20)/b6-5- |
| InChIKey | HREZNHTVGAVXAC-WAYWQWQTSA-N |
| XLogP | 1.23 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|