C14H17NO3 — CID 96561918
methyl 3-[[(Z)-3-(3-methylphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 96561918) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is methyl 3-[[(Z)-3-(3-methylphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | methyl 3-[[(Z)-3-(3-methylphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 96561918 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | methyl 3-[[(Z)-3-(3-methylphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)/C=C\c1cccc(C)c1 |
| InChI | InChI=1S/C14H17NO3/c1-11-4-3-5-12(10-11)6-7-13(16)15-9-8-14(17)18-2/h3-7,10H,8-9H2,1-2H3,(H,15,16)/b7-6- |
| InChIKey | WZDXICYQWIGITH-SREVYHEPSA-N |
| XLogP | 1.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|