C15H19NO3 — CID 134015690
methyl 3-[[(E)-3-(3-methylphenyl)prop-2-enoyl]amino]butanoate (PubChem CID 134015690) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(3-methylphenyl)prop-2-enoyl]amino]butanoate.
| Compound Name | methyl 3-[[(E)-3-(3-methylphenyl)prop-2-enoyl]amino]butanoate |
|---|---|
| PubChem CID | 134015690 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | methyl 3-[[(E)-3-(3-methylphenyl)prop-2-enoyl]amino]butanoate |
| SMILES | COC(=O)CC(C)NC(=O)/C=C/c1cccc(C)c1 |
| InChI | InChI=1S/C15H19NO3/c1-11-5-4-6-13(9-11)7-8-14(17)16-12(2)10-15(18)19-3/h4-9,12H,10H2,1-3H3,(H,16,17)/b8-7+ |
| InChIKey | LMLGSRNSCPTHAU-BQYQJAHWSA-N |
| XLogP | 2.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|