C13H17NO3 — CID 77065093
N-(1,3-dihydroxypropan-2-yl)-3-(3-methylphenyl)prop-2-enamide (PubChem CID 77065093) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-3-(3-methylphenyl)prop-2-enamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-3-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 77065093 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-3-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(C=CC(=O)NC(CO)CO)c1 |
| InChI | InChI=1S/C13H17NO3/c1-10-3-2-4-11(7-10)5-6-13(17)14-12(8-15)9-16/h2-7,12,15-16H,8-9H2,1H3,(H,14,17) |
| InChIKey | VBRCQNQZVLIFHF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|