C13H15NO3 — CID 43092435
3-[[(E)-3-phenylprop-2-enoyl]amino]butanoic acid (PubChem CID 43092435) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-[[(E)-3-phenylprop-2-enoyl]amino]butanoic acid.
| Compound Name | 3-[[(E)-3-phenylprop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43092435 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-[[(E)-3-phenylprop-2-enoyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H15NO3/c1-10(9-13(16)17)14-12(15)8-7-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,14,15)(H,16,17)/b8-7+ |
| InChIKey | FZYAQZZXDXIMEB-BQYQJAHWSA-N |
| XLogP | 1.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|