C15H20N2O3 — CID 110887309
N-(1-hydroxypropan-2-yl)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide (PubChem CID 110887309) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 110887309 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
| SMILES | CC(CO)NC(=O)C(C)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c1-11(10-18)16-15(20)12(2)17-14(19)9-8-13-6-4-3-5-7-13/h3-9,11-12,18H,10H2,1-2H3,(H,16,20)(H,17,19)/b9-8+ |
| InChIKey | SKUVASWJSYOUQN-CMDGGOBGSA-N |
| XLogP | 0.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|