C15H18ClNO3 — CID 76872175
ethyl 4-[3-(3-chlorophenyl)prop-2-enoylamino]butanoate (PubChem CID 76872175) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is ethyl 4-[3-(3-chlorophenyl)prop-2-enoylamino]butanoate.
| Compound Name | ethyl 4-[3-(3-chlorophenyl)prop-2-enoylamino]butanoate |
|---|---|
| PubChem CID | 76872175 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | ethyl 4-[3-(3-chlorophenyl)prop-2-enoylamino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)C=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H18ClNO3/c1-2-20-15(19)7-4-10-17-14(18)9-8-12-5-3-6-13(16)11-12/h3,5-6,8-9,11H,2,4,7,10H2,1H3,(H,17,18) |
| InChIKey | QKSXQAUZJNGPDM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|