C25H28Cl2N2O2 — CID 6167041
(E)-3-(3-chlorophenyl)-N-[7-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]heptyl]prop-2-enamide (PubChem CID 6167041) has the molecular formula C25H28Cl2N2O2 and a molecular weight of 459.42 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-[7-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]heptyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-[7-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]heptyl]prop-2-enamide |
|---|---|
| PubChem CID | 6167041 |
| Molecular Formula | C25H28Cl2N2O2 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-[7-[[(E)-3-(3-chlorophenyl)prop-2-enoyl]amino]heptyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)NCCCCCCCNC(=O)/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H28Cl2N2O2/c26-22-10-6-8-20(18-22)12-14-24(30)28-16-4-2-1-3-5-17-29-25(31)15-13-21-9-7-11-23(27)19-21/h6-15,18-19H,1-5,16-17H2,(H,28,30)(H,29,31)/b14-12+,15-13+ |
| InChIKey | OZMCSJRAGFGQDI-QUMQEAAQSA-N |
| XLogP | 5.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|