C17H16ClNOS — CID 9482873
(E)-3-(3-chlorophenyl)-N-(2-phenylsulfanylethyl)prop-2-enamide (PubChem CID 9482873) has the molecular formula C17H16ClNOS and a molecular weight of 317.84 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-(2-phenylsulfanylethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-(2-phenylsulfanylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 9482873 |
| Molecular Formula | C17H16ClNOS |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-(2-phenylsulfanylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)NCCSc1ccccc1 |
| InChI | InChI=1S/C17H16ClNOS/c18-15-6-4-5-14(13-15)9-10-17(20)19-11-12-21-16-7-2-1-3-8-16/h1-10,13H,11-12H2,(H,19,20)/b10-9+ |
| InChIKey | ASIHEQKYFFEBOP-MDZDMXLPSA-N |
| XLogP | 4.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|