C12H11Cl2NO — CID 115636575
(E)-3-(3-chlorophenyl)-N-(2-chloroprop-2-enyl)prop-2-enamide (PubChem CID 115636575) has the molecular formula C12H11Cl2NO and a molecular weight of 256.13 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-(2-chloroprop-2-enyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-(2-chloroprop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 115636575 |
| Molecular Formula | C12H11Cl2NO |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-(2-chloroprop-2-enyl)prop-2-enamide |
| SMILES | C=C(Cl)CNC(=O)/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2NO/c1-9(13)8-15-12(16)6-5-10-3-2-4-11(14)7-10/h2-7H,1,8H2,(H,15,16)/b6-5+ |
| InChIKey | XEMDUMSPSACEIY-AATRIKPKSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|