C19H20N2O2S — CID 134002494
N-methyl-4-[(E)-3-oxo-3-(2-phenylsulfanylethylamino)prop-1-enyl]benzamide (PubChem CID 134002494) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is N-methyl-4-[(E)-3-oxo-3-(2-phenylsulfanylethylamino)prop-1-enyl]benzamide.
| Compound Name | N-methyl-4-[(E)-3-oxo-3-(2-phenylsulfanylethylamino)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 134002494 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-methyl-4-[(E)-3-oxo-3-(2-phenylsulfanylethylamino)prop-1-enyl]benzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)NCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O2S/c1-20-19(23)16-10-7-15(8-11-16)9-12-18(22)21-13-14-24-17-5-3-2-4-6-17/h2-12H,13-14H2,1H3,(H,20,23)(H,21,22)/b12-9+ |
| InChIKey | YHJGGXQTGZRVGV-FMIVXFBMSA-N |
| XLogP | 2.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|