C16H21ClN2O — CID 47209384
(E)-3-(3-chlorophenyl)-N-(2-piperidin-1-ylethyl)prop-2-enamide (PubChem CID 47209384) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-(2-piperidin-1-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-(2-piperidin-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 47209384 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-(2-piperidin-1-ylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)NCCN1CCCCC1 |
| InChI | InChI=1S/C16H21ClN2O/c17-15-6-4-5-14(13-15)7-8-16(20)18-9-12-19-10-2-1-3-11-19/h4-8,13H,1-3,9-12H2,(H,18,20)/b8-7+ |
| InChIKey | DJKYTDSVXIEYFI-BQYQJAHWSA-N |
| XLogP | 2.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|