C19H17ClN2O — CID 108750521
(E)-3-(3-chlorophenyl)-N-(2-indol-1-ylethyl)prop-2-enamide (PubChem CID 108750521) has the molecular formula C19H17ClN2O and a molecular weight of 324.81 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-(2-indol-1-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-(2-indol-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108750521 |
| Molecular Formula | C19H17ClN2O |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-(2-indol-1-ylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)NCCn1ccc2ccccc21 |
| InChI | InChI=1S/C19H17ClN2O/c20-17-6-3-4-15(14-17)8-9-19(23)21-11-13-22-12-10-16-5-1-2-7-18(16)22/h1-10,12,14H,11,13H2,(H,21,23)/b9-8+ |
| InChIKey | MIGVXWMOHILBDP-CMDGGOBGSA-N |
| XLogP | 4.12 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|